C9H15F3N2OS — CID 106427357
2-amino-3,3,3-trifluoro-2-methyl-N-(2-prop-2-enylsulfanylethyl)propanamide (PubChem CID 106427357) has the molecular formula C9H15F3N2OS and a molecular weight of 256.29 g/mol. Its IUPAC name is 2-amino-3,3,3-trifluoro-2-methyl-N-(2-prop-2-enylsulfanylethyl)propanamide.
| Compound Name | 2-amino-3,3,3-trifluoro-2-methyl-N-(2-prop-2-enylsulfanylethyl)propanamide |
|---|---|
| PubChem CID | 106427357 |
| Molecular Formula | C9H15F3N2OS |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 2-amino-3,3,3-trifluoro-2-methyl-N-(2-prop-2-enylsulfanylethyl)propanamide |
| SMILES | C=CCSCCNC(=O)C(C)(N)C(F)(F)F |
| InChI | InChI=1S/C9H15F3N2OS/c1-3-5-16-6-4-14-7(15)8(2,13)9(10,11)12/h3H,1,4-6,13H2,2H3,(H,14,15) |
| InChIKey | FAMOTKMHCOQCOX-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|