C13H20N2S2 — CID 106428545
N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-prop-2-ynylsulfanylethanamine (PubChem CID 106428545) has the molecular formula C13H20N2S2 and a molecular weight of 268.45 g/mol. Its IUPAC name is N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-prop-2-ynylsulfanylethanamine.
| Compound Name | N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-prop-2-ynylsulfanylethanamine |
|---|---|
| PubChem CID | 106428545 |
| Molecular Formula | C13H20N2S2 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-prop-2-ynylsulfanylethanamine |
| SMILES | C#CCSCCNCc1nc(C(C)(C)C)cs1 |
| InChI | InChI=1S/C13H20N2S2/c1-5-7-16-8-6-14-9-12-15-11(10-17-12)13(2,3)4/h1,10,14H,6-9H2,2-4H3 |
| InChIKey | YHZRTODRYNYXJI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|