C13H23ClN2S — CID 107319889
N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-5-chloropentan-1-amine (PubChem CID 107319889) has the molecular formula C13H23ClN2S and a molecular weight of 274.86 g/mol. Its IUPAC name is N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-5-chloropentan-1-amine.
| Compound Name | N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-5-chloropentan-1-amine |
|---|---|
| PubChem CID | 107319889 |
| Molecular Formula | C13H23ClN2S |
| Molecular Weight | 274.86 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-5-chloropentan-1-amine |
| SMILES | CC(C)(C)c1csc(CNCCCCCCl)n1 |
| InChI | InChI=1S/C13H23ClN2S/c1-13(2,3)11-10-17-12(16-11)9-15-8-6-4-5-7-14/h10,15H,4-9H2,1-3H3 |
| InChIKey | MDZCPQNPAZEZCW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.86 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|