C12H21N3O2S — CID 106237942
2-[2-[(4-tert-butyl-1,3-thiazol-2-yl)methylamino]ethoxy]acetamide (PubChem CID 106237942) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is 2-[2-[(4-tert-butyl-1,3-thiazol-2-yl)methylamino]ethoxy]acetamide.
| Compound Name | 2-[2-[(4-tert-butyl-1,3-thiazol-2-yl)methylamino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106237942 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2-[2-[(4-tert-butyl-1,3-thiazol-2-yl)methylamino]ethoxy]acetamide |
| SMILES | CC(C)(C)c1csc(CNCCOCC(N)=O)n1 |
| InChI | InChI=1S/C12H21N3O2S/c1-12(2,3)9-8-18-11(15-9)6-14-4-5-17-7-10(13)16/h8,14H,4-7H2,1-3H3,(H2,13,16) |
| InChIKey | VRHSMOCJEMZKLU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|