C12H21N3OS — CID 119878910
4-amino-N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]butanamide (PubChem CID 119878910) has the molecular formula C12H21N3OS and a molecular weight of 255.39 g/mol. Its IUPAC name is 4-amino-N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]butanamide.
| Compound Name | 4-amino-N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]butanamide |
|---|---|
| PubChem CID | 119878910 |
| Molecular Formula | C12H21N3OS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 4-amino-N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]butanamide |
| SMILES | CC(C)(C)c1csc(CNC(=O)CCCN)n1 |
| InChI | InChI=1S/C12H21N3OS/c1-12(2,3)9-8-17-11(15-9)7-14-10(16)5-4-6-13/h8H,4-7,13H2,1-3H3,(H,14,16) |
| InChIKey | VQRDRBACXFZVBO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |