C13H25Cl2N3OS — CID 119878856
N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-4-(methylamino)butanamide;dihydrochloride (PubChem CID 119878856) has the molecular formula C13H25Cl2N3OS and a molecular weight of 342.34 g/mol. Its IUPAC name is N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-4-(methylamino)butanamide;dihydrochloride.
| Compound Name | N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-4-(methylamino)butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119878856 |
| Molecular Formula | C13H25Cl2N3OS |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-4-(methylamino)butanamide;dihydrochloride |
| SMILES | CNCCCC(=O)NCc1nc(C(C)(C)C)cs1.Cl.Cl |
| InChI | InChI=1S/C13H23N3OS.2ClH/c1-13(2,3)10-9-18-12(16-10)8-15-11(17)6-5-7-14-4;;/h9,14H,5-8H2,1-4H3,(H,15,17);2*1H |
| InChIKey | GLDKTVMFLYXTNM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|