C12H23Cl2N3O2S — CID 119900108
N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-4-(methylamino)butanamide;dihydrochloride (PubChem CID 119900108) has the molecular formula C12H23Cl2N3O2S and a molecular weight of 344.31 g/mol. Its IUPAC name is N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-4-(methylamino)butanamide;dihydrochloride.
| Compound Name | N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-4-(methylamino)butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119900108 |
| Molecular Formula | C12H23Cl2N3O2S |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-4-(methylamino)butanamide;dihydrochloride |
| SMILES | CNCCCC(=O)NCc1csc(C(C)OC)n1.Cl.Cl |
| InChI | InChI=1S/C12H21N3O2S.2ClH/c1-9(17-3)12-15-10(8-18-12)7-14-11(16)5-4-6-13-2;;/h8-9,13H,4-7H2,1-3H3,(H,14,16);2*1H |
| InChIKey | FTDBDOMZOWOBPG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|