C11H13ClN2O2S — CID 106429326
3-chloro-6-(2-prop-2-enylsulfanylethylamino)pyridine-2-carboxylic acid (PubChem CID 106429326) has the molecular formula C11H13ClN2O2S and a molecular weight of 272.76 g/mol. Its IUPAC name is 3-chloro-6-(2-prop-2-enylsulfanylethylamino)pyridine-2-carboxylic acid.
| Compound Name | 3-chloro-6-(2-prop-2-enylsulfanylethylamino)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 106429326 |
| Molecular Formula | C11H13ClN2O2S |
| Molecular Weight | 272.76 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 3-chloro-6-(2-prop-2-enylsulfanylethylamino)pyridine-2-carboxylic acid |
| SMILES | C=CCSCCNc1ccc(Cl)c(C(=O)O)n1 |
| InChI | InChI=1S/C11H13ClN2O2S/c1-2-6-17-7-5-13-9-4-3-8(12)10(14-9)11(15)16/h2-4H,1,5-7H2,(H,13,14)(H,15,16) |
| InChIKey | PLSVDVMBFDMXDA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.76 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|