C8H10ClN3O2 — CID 61402986
6-(2-aminoethylamino)-3-chloropyridine-2-carboxylic acid (PubChem CID 61402986) has the molecular formula C8H10ClN3O2 and a molecular weight of 215.64 g/mol. Its IUPAC name is 6-(2-aminoethylamino)-3-chloropyridine-2-carboxylic acid.
| Compound Name | 6-(2-aminoethylamino)-3-chloropyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 61402986 |
| Molecular Formula | C8H10ClN3O2 |
| Molecular Weight | 215.64 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 6-(2-aminoethylamino)-3-chloropyridine-2-carboxylic acid |
| SMILES | NCCNc1ccc(Cl)c(C(=O)O)n1 |
| InChI | InChI=1S/C8H10ClN3O2/c9-5-1-2-6(11-4-3-10)12-7(5)8(13)14/h1-2H,3-4,10H2,(H,11,12)(H,13,14) |
| InChIKey | IOHWQDBFXDMVGD-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.64 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |