C15H14N2O2S — CID 106429505
2-(2-prop-2-ynylsulfanylethylamino)quinoline-5-carboxylic acid (PubChem CID 106429505) has the molecular formula C15H14N2O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is 2-(2-prop-2-ynylsulfanylethylamino)quinoline-5-carboxylic acid.
| Compound Name | 2-(2-prop-2-ynylsulfanylethylamino)quinoline-5-carboxylic acid |
|---|---|
| PubChem CID | 106429505 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-(2-prop-2-ynylsulfanylethylamino)quinoline-5-carboxylic acid |
| SMILES | C#CCSCCNc1ccc2c(C(=O)O)cccc2n1 |
| InChI | InChI=1S/C15H14N2O2S/c1-2-9-20-10-8-16-14-7-6-11-12(15(18)19)4-3-5-13(11)17-14/h1,3-7H,8-10H2,(H,16,17)(H,18,19) |
| InChIKey | CMWBMWSPEYFLAL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|