C8H8F3N3O2S — CID 106429575
6-[2-(trifluoromethylsulfanyl)ethylamino]pyrazine-2-carboxylic acid (PubChem CID 106429575) has the molecular formula C8H8F3N3O2S and a molecular weight of 267.23 g/mol. Its IUPAC name is 6-[2-(trifluoromethylsulfanyl)ethylamino]pyrazine-2-carboxylic acid.
| Compound Name | 6-[2-(trifluoromethylsulfanyl)ethylamino]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 106429575 |
| Molecular Formula | C8H8F3N3O2S |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 6-[2-(trifluoromethylsulfanyl)ethylamino]pyrazine-2-carboxylic acid |
| SMILES | O=C(O)c1cncc(NCCSC(F)(F)F)n1 |
| InChI | InChI=1S/C8H8F3N3O2S/c9-8(10,11)17-2-1-13-6-4-12-3-5(14-6)7(15)16/h3-4H,1-2H2,(H,13,14)(H,15,16) |
| InChIKey | HHKSJGMVUFJHRA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|