C8H9F3N2O4S — CID 106429706
(E)-4-oxo-4-[2-(trifluoromethylsulfanyl)ethylcarbamoylamino]but-2-enoic acid (PubChem CID 106429706) has the molecular formula C8H9F3N2O4S and a molecular weight of 286.23 g/mol. Its IUPAC name is (E)-4-oxo-4-[2-(trifluoromethylsulfanyl)ethylcarbamoylamino]but-2-enoic acid.
| Compound Name | (E)-4-oxo-4-[2-(trifluoromethylsulfanyl)ethylcarbamoylamino]but-2-enoic acid |
|---|---|
| PubChem CID | 106429706 |
| Molecular Formula | C8H9F3N2O4S |
| Molecular Weight | 286.23 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | (E)-4-oxo-4-[2-(trifluoromethylsulfanyl)ethylcarbamoylamino]but-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)NC(=O)NCCSC(F)(F)F |
| InChI | InChI=1S/C8H9F3N2O4S/c9-8(10,11)18-4-3-12-7(17)13-5(14)1-2-6(15)16/h1-2H,3-4H2,(H,15,16)(H2,12,13,14,17)/b2-1+ |
| InChIKey | QYCZCZQWPCOYOR-OWOJBTEDSA-N |
| XLogP | 0.71 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.23 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|