C22H30O5 — CID 10643142
diethyl (3R,4R)-2-[(1E)-4-methylpenta-1,3-dienyl]-4-(2-methylprop-1-enyl)-6-oxocyclohexene-1,3-dicarboxylate (PubChem CID 10643142) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is diethyl (3R,4R)-2-[(1E)-4-methylpenta-1,3-dienyl]-4-(2-methylprop-1-enyl)-6-oxocyclohexene-1,3-dicarboxylate.
| Compound Name | diethyl (3R,4R)-2-[(1E)-4-methylpenta-1,3-dienyl]-4-(2-methylprop-1-enyl)-6-oxocyclohexene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 10643142 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | diethyl (3R,4R)-2-[(1E)-4-methylpenta-1,3-dienyl]-4-(2-methylprop-1-enyl)-6-oxocyclohexene-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1=C(/C=C/C=C(C)C)[C@H](C(=O)OCC)[C@@H](C=C(C)C)CC1=O |
| InChI | InChI=1S/C22H30O5/c1-7-26-21(24)19-16(12-15(5)6)13-18(23)20(22(25)27-8-2)17(19)11-9-10-14(3)4/h9-12,16,19H,7-8,13H2,1-6H3/b11-9+/t16-,19+/m0/s1 |
| InChIKey | VBJKFCLKMHZCCP-XABOCNADSA-N |
| XLogP | 4.10 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|