C9H11BrClN3S — CID 106431867
5-bromo-2-chloro-N-(2-prop-2-enylsulfanylethyl)pyrimidin-4-amine (PubChem CID 106431867) has the molecular formula C9H11BrClN3S and a molecular weight of 308.63 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-(2-prop-2-enylsulfanylethyl)pyrimidin-4-amine.
| Compound Name | 5-bromo-2-chloro-N-(2-prop-2-enylsulfanylethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106431867 |
| Molecular Formula | C9H11BrClN3S |
| Molecular Weight | 308.63 g/mol |
| Exact Mass | 306.95 |
| IUPAC Name | 5-bromo-2-chloro-N-(2-prop-2-enylsulfanylethyl)pyrimidin-4-amine |
| SMILES | C=CCSCCNc1nc(Cl)ncc1Br |
| InChI | InChI=1S/C9H11BrClN3S/c1-2-4-15-5-3-12-8-7(10)6-13-9(11)14-8/h2,6H,1,3-5H2,(H,12,13,14) |
| InChIKey | UAUVNYVFYPPYGC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.63 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|