C12H15BrN2O3S2 — CID 106432212
3-bromo-N-(2-prop-2-enylsulfanylethyl)-5-sulfamoylbenzamide (PubChem CID 106432212) has the molecular formula C12H15BrN2O3S2 and a molecular weight of 379.30 g/mol. Its IUPAC name is 3-bromo-N-(2-prop-2-enylsulfanylethyl)-5-sulfamoylbenzamide.
| Compound Name | 3-bromo-N-(2-prop-2-enylsulfanylethyl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 106432212 |
| Molecular Formula | C12H15BrN2O3S2 |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | 3-bromo-N-(2-prop-2-enylsulfanylethyl)-5-sulfamoylbenzamide |
| SMILES | C=CCSCCNC(=O)c1cc(Br)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C12H15BrN2O3S2/c1-2-4-19-5-3-15-12(16)9-6-10(13)8-11(7-9)20(14,17)18/h2,6-8H,1,3-5H2,(H,15,16)(H2,14,17,18) |
| InChIKey | ISPJAXKMDOBPNM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|