C14H16N2O3S — CID 106434312
2-(4-aminophenoxy)-N-(2-hydroxy-2-thiophen-3-ylethyl)acetamide (PubChem CID 106434312) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is 2-(4-aminophenoxy)-N-(2-hydroxy-2-thiophen-3-ylethyl)acetamide.
| Compound Name | 2-(4-aminophenoxy)-N-(2-hydroxy-2-thiophen-3-ylethyl)acetamide |
|---|---|
| PubChem CID | 106434312 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 2-(4-aminophenoxy)-N-(2-hydroxy-2-thiophen-3-ylethyl)acetamide |
| SMILES | Nc1ccc(OCC(=O)NCC(O)c2ccsc2)cc1 |
| InChI | InChI=1S/C14H16N2O3S/c15-11-1-3-12(4-2-11)19-8-14(18)16-7-13(17)10-5-6-20-9-10/h1-6,9,13,17H,7-8,15H2,(H,16,18) |
| InChIKey | NPYPGZXZHBQWJT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|