C8H14ClNS — CID 106438169
N-(3-chloro-2-methylprop-2-enyl)thiolan-3-amine (PubChem CID 106438169) has the molecular formula C8H14ClNS and a molecular weight of 191.73 g/mol. Its IUPAC name is N-(3-chloro-2-methylprop-2-enyl)thiolan-3-amine.
| Compound Name | N-(3-chloro-2-methylprop-2-enyl)thiolan-3-amine |
|---|---|
| PubChem CID | 106438169 |
| Molecular Formula | C8H14ClNS |
| Molecular Weight | 191.73 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | N-(3-chloro-2-methylprop-2-enyl)thiolan-3-amine |
| SMILES | CC(=CCl)CNC1CCSC1 |
| InChI | InChI=1S/C8H14ClNS/c1-7(4-9)5-10-8-2-3-11-6-8/h4,8,10H,2-3,5-6H2,1H3 |
| InChIKey | PUESECVOZYUWJK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.73 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |