C13H25ClN2 — CID 106440349
2-tert-butyl-1-(3-chloro-2-methylprop-2-enyl)-5-methylpiperazine (PubChem CID 106440349) has the molecular formula C13H25ClN2 and a molecular weight of 244.81 g/mol. Its IUPAC name is 2-tert-butyl-1-(3-chloro-2-methylprop-2-enyl)-5-methylpiperazine.
| Compound Name | 2-tert-butyl-1-(3-chloro-2-methylprop-2-enyl)-5-methylpiperazine |
|---|---|
| PubChem CID | 106440349 |
| Molecular Formula | C13H25ClN2 |
| Molecular Weight | 244.81 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 2-tert-butyl-1-(3-chloro-2-methylprop-2-enyl)-5-methylpiperazine |
| SMILES | CC(=CCl)CN1CC(C)NCC1C(C)(C)C |
| InChI | InChI=1S/C13H25ClN2/c1-10(6-14)8-16-9-11(2)15-7-12(16)13(3,4)5/h6,11-12,15H,7-9H2,1-5H3 |
| InChIKey | KHTMRIQPAZNBHU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.81 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |