C12H23F3N2 — CID 64845759
2-tert-butyl-5-methyl-1-(3,3,3-trifluoropropyl)piperazine (PubChem CID 64845759) has the molecular formula C12H23F3N2 and a molecular weight of 252.32 g/mol. Its IUPAC name is 2-tert-butyl-5-methyl-1-(3,3,3-trifluoropropyl)piperazine.
| Compound Name | 2-tert-butyl-5-methyl-1-(3,3,3-trifluoropropyl)piperazine |
|---|---|
| PubChem CID | 64845759 |
| Molecular Formula | C12H23F3N2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 2-tert-butyl-5-methyl-1-(3,3,3-trifluoropropyl)piperazine |
| SMILES | CC1CN(CCC(F)(F)F)C(C(C)(C)C)CN1 |
| InChI | InChI=1S/C12H23F3N2/c1-9-8-17(6-5-12(13,14)15)10(7-16-9)11(2,3)4/h9-10,16H,5-8H2,1-4H3 |
| InChIKey | GTAPWXNSDRKHSJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |