C15H32N2 — CID 64845180
2-tert-butyl-1-(3,3-dimethylbutyl)-5-methylpiperazine (PubChem CID 64845180) has the molecular formula C15H32N2 and a molecular weight of 240.43 g/mol. Its IUPAC name is 2-tert-butyl-1-(3,3-dimethylbutyl)-5-methylpiperazine.
| Compound Name | 2-tert-butyl-1-(3,3-dimethylbutyl)-5-methylpiperazine |
|---|---|
| PubChem CID | 64845180 |
| Molecular Formula | C15H32N2 |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.26 |
| IUPAC Name | 2-tert-butyl-1-(3,3-dimethylbutyl)-5-methylpiperazine |
| SMILES | CC1CN(CCC(C)(C)C)C(C(C)(C)C)CN1 |
| InChI | InChI=1S/C15H32N2/c1-12-11-17(9-8-14(2,3)4)13(10-16-12)15(5,6)7/h12-13,16H,8-11H2,1-7H3 |
| InChIKey | UJCUJIZHGJXWBH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |