C27H21NO2 — CID 10644179
(1S,8S,9S,10R)-12-benzyl-9-phenyl-12-azatetracyclo[6.5.2.01,10.02,7]pentadeca-2,4,6,14-tetraene-11,13-dione (PubChem CID 10644179) has the molecular formula C27H21NO2 and a molecular weight of 391.47 g/mol. Its IUPAC name is (1S,8S,9S,10R)-12-benzyl-9-phenyl-12-azatetracyclo[6.5.2.01,10.02,7]pentadeca-2,4,6,14-tetraene-11,13-dione.
| Compound Name | (1S,8S,9S,10R)-12-benzyl-9-phenyl-12-azatetracyclo[6.5.2.01,10.02,7]pentadeca-2,4,6,14-tetraene-11,13-dione |
|---|---|
| PubChem CID | 10644179 |
| Molecular Formula | C27H21NO2 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | (1S,8S,9S,10R)-12-benzyl-9-phenyl-12-azatetracyclo[6.5.2.01,10.02,7]pentadeca-2,4,6,14-tetraene-11,13-dione |
| SMILES | O=C1[C@@H]2[C@@H](c3ccccc3)[C@@H]3C=C[C@@]2(C(=O)N1Cc1ccccc1)c1ccccc13 |
| InChI | InChI=1S/C27H21NO2/c29-25-24-23(19-11-5-2-6-12-19)21-15-16-27(24,22-14-8-7-13-20(21)22)26(30)28(25)17-18-9-3-1-4-10-18/h1-16,21,23-24H,17H2/t21-,23+,24+,27-/m1/s1 |
| InChIKey | QMFLBPKXLJEHEH-VHENIMGFSA-N |
| XLogP | 4.56 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|