C33H25NO2 — CID 10766670
(1S,8R,10R)-12-benzyl-9,9-diphenyl-12-azatetracyclo[6.5.2.01,10.02,7]pentadeca-2,4,6,14-tetraene-11,13-dione (PubChem CID 10766670) has the molecular formula C33H25NO2 and a molecular weight of 467.57 g/mol. Its IUPAC name is (1S,8R,10R)-12-benzyl-9,9-diphenyl-12-azatetracyclo[6.5.2.01,10.02,7]pentadeca-2,4,6,14-tetraene-11,13-dione.
| Compound Name | (1S,8R,10R)-12-benzyl-9,9-diphenyl-12-azatetracyclo[6.5.2.01,10.02,7]pentadeca-2,4,6,14-tetraene-11,13-dione |
|---|---|
| PubChem CID | 10766670 |
| Molecular Formula | C33H25NO2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | (1S,8R,10R)-12-benzyl-9,9-diphenyl-12-azatetracyclo[6.5.2.01,10.02,7]pentadeca-2,4,6,14-tetraene-11,13-dione |
| SMILES | O=C1[C@@H]2C(c3ccccc3)(c3ccccc3)[C@@H]3C=C[C@@]2(C(=O)N1Cc1ccccc1)c1ccccc13 |
| InChI | InChI=1S/C33H25NO2/c35-30-29-32(31(36)34(30)22-23-12-4-1-5-13-23)21-20-28(26-18-10-11-19-27(26)32)33(29,24-14-6-2-7-15-24)25-16-8-3-9-17-25/h1-21,28-29H,22H2/t28-,29+,32-/m1/s1 |
| InChIKey | ZRSXMPTUAQLESI-VQCQPQSOSA-N |
| XLogP | 5.76 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|