C33H23NO2 — CID 11236643
(5R,12S)-3-benzyl-3-azaheptacyclo[11.6.6.25,12.01,5.06,11.014,19.020,25]heptacosa-6,8,10,14,16,18,20,22,24,26-decaene-2,4-dione (PubChem CID 11236643) has the molecular formula C33H23NO2 and a molecular weight of 465.55 g/mol. Its IUPAC name is (5R,12S)-3-benzyl-3-azaheptacyclo[11.6.6.25,12.01,5.06,11.014,19.020,25]heptacosa-6,8,10,14,16,18,20,22,24,26-decaene-2,4-dione.
| Compound Name | (5R,12S)-3-benzyl-3-azaheptacyclo[11.6.6.25,12.01,5.06,11.014,19.020,25]heptacosa-6,8,10,14,16,18,20,22,24,26-decaene-2,4-dione |
|---|---|
| PubChem CID | 11236643 |
| Molecular Formula | C33H23NO2 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | (5R,12S)-3-benzyl-3-azaheptacyclo[11.6.6.25,12.01,5.06,11.014,19.020,25]heptacosa-6,8,10,14,16,18,20,22,24,26-decaene-2,4-dione |
| SMILES | O=C1N(Cc2ccccc2)C(=O)[C@]23C=C[C@H](c4ccccc42)C2c4ccccc4C13c1ccccc12 |
| InChI | InChI=1S/C33H23NO2/c35-30-32-19-18-23(22-12-4-7-15-26(22)32)29-24-13-5-8-16-27(24)33(32,28-17-9-6-14-25(28)29)31(36)34(30)20-21-10-2-1-3-11-21/h1-19,23,29H,20H2/t23-,29?,32+,33?/m1/s1 |
| InChIKey | PQMVKNHRWFZRRF-YXOGJLOMSA-N |
| XLogP | 5.59 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|