C15H30N2O3S — CID 106442510
(2R)-2-amino-3-methyl-3-[2-(6-methylheptan-2-ylamino)-2-oxoethyl]sulfanylbutanoic acid (PubChem CID 106442510) has the molecular formula C15H30N2O3S and a molecular weight of 318.48 g/mol. Its IUPAC name is (2R)-2-amino-3-methyl-3-[2-(6-methylheptan-2-ylamino)-2-oxoethyl]sulfanylbutanoic acid.
| Compound Name | (2R)-2-amino-3-methyl-3-[2-(6-methylheptan-2-ylamino)-2-oxoethyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 106442510 |
| Molecular Formula | C15H30N2O3S |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | (2R)-2-amino-3-methyl-3-[2-(6-methylheptan-2-ylamino)-2-oxoethyl]sulfanylbutanoic acid |
| SMILES | CC(C)CCCC(C)NC(=O)CSC(C)(C)[C@H](N)C(=O)O |
| InChI | InChI=1S/C15H30N2O3S/c1-10(2)7-6-8-11(3)17-12(18)9-21-15(4,5)13(16)14(19)20/h10-11,13H,6-9,16H2,1-5H3,(H,17,18)(H,19,20)/t11?,13-/m1/s1 |
| InChIKey | NPKKPVFZXQYVHT-GLGOKHISSA-N |
| XLogP | 2.24 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |