C14H24N2O3S — CID 106443409
(2S)-2-amino-3-[2-(3-ethylpent-1-yn-3-ylamino)-2-oxoethyl]sulfanyl-3-methylbutanoic acid (PubChem CID 106443409) has the molecular formula C14H24N2O3S and a molecular weight of 300.42 g/mol. Its IUPAC name is (2S)-2-amino-3-[2-(3-ethylpent-1-yn-3-ylamino)-2-oxoethyl]sulfanyl-3-methylbutanoic acid.
| Compound Name | (2S)-2-amino-3-[2-(3-ethylpent-1-yn-3-ylamino)-2-oxoethyl]sulfanyl-3-methylbutanoic acid |
|---|---|
| PubChem CID | 106443409 |
| Molecular Formula | C14H24N2O3S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | (2S)-2-amino-3-[2-(3-ethylpent-1-yn-3-ylamino)-2-oxoethyl]sulfanyl-3-methylbutanoic acid |
| SMILES | C#CC(CC)(CC)NC(=O)CSC(C)(C)[C@@H](N)C(=O)O |
| InChI | InChI=1S/C14H24N2O3S/c1-6-14(7-2,8-3)16-10(17)9-20-13(4,5)11(15)12(18)19/h1,11H,7-9,15H2,2-5H3,(H,16,17)(H,18,19)/t11-/m0/s1 |
| InChIKey | JJKUEZNSUKSGDC-NSHDSACASA-N |
| XLogP | 1.22 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|