C13H21N3O3S — CID 106442838
(2R)-2-amino-3-[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl]sulfanyl-3-methylbutanoic acid (PubChem CID 106442838) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is (2R)-2-amino-3-[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl]sulfanyl-3-methylbutanoic acid.
| Compound Name | (2R)-2-amino-3-[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl]sulfanyl-3-methylbutanoic acid |
|---|---|
| PubChem CID | 106442838 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (2R)-2-amino-3-[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl]sulfanyl-3-methylbutanoic acid |
| SMILES | CC(C)(SCC(=O)NC1(C#N)CCCC1)[C@H](N)C(=O)O |
| InChI | InChI=1S/C13H21N3O3S/c1-12(2,10(15)11(18)19)20-7-9(17)16-13(8-14)5-3-4-6-13/h10H,3-7,15H2,1-2H3,(H,16,17)(H,18,19)/t10-/m1/s1 |
| InChIKey | WVBKGIASGMMXIA-SNVBAGLBSA-N |
| XLogP | 0.86 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |