C14H23N3O3S — CID 106443574
(2S)-2-amino-3-[2-[(1-cyanocyclohexyl)amino]-2-oxoethyl]sulfanyl-3-methylbutanoic acid (PubChem CID 106443574) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is (2S)-2-amino-3-[2-[(1-cyanocyclohexyl)amino]-2-oxoethyl]sulfanyl-3-methylbutanoic acid.
| Compound Name | (2S)-2-amino-3-[2-[(1-cyanocyclohexyl)amino]-2-oxoethyl]sulfanyl-3-methylbutanoic acid |
|---|---|
| PubChem CID | 106443574 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (2S)-2-amino-3-[2-[(1-cyanocyclohexyl)amino]-2-oxoethyl]sulfanyl-3-methylbutanoic acid |
| SMILES | CC(C)(SCC(=O)NC1(C#N)CCCCC1)[C@@H](N)C(=O)O |
| InChI | InChI=1S/C14H23N3O3S/c1-13(2,11(16)12(19)20)21-8-10(18)17-14(9-15)6-4-3-5-7-14/h11H,3-8,16H2,1-2H3,(H,17,18)(H,19,20)/t11-/m0/s1 |
| InChIKey | UUAMEYFSRIZMSI-NSHDSACASA-N |
| XLogP | 1.25 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |