C20H27NO7 — CID 10644276
tert-butyl [(2-methylpropan-2-yl)oxycarbonyl-(3-oxo-4-phenylbutanoyl)amino] carbonate (PubChem CID 10644276) has the molecular formula C20H27NO7 and a molecular weight of 393.44 g/mol. Its IUPAC name is tert-butyl [(2-methylpropan-2-yl)oxycarbonyl-(3-oxo-4-phenylbutanoyl)amino] carbonate.
| Compound Name | tert-butyl [(2-methylpropan-2-yl)oxycarbonyl-(3-oxo-4-phenylbutanoyl)amino] carbonate |
|---|---|
| PubChem CID | 10644276 |
| Molecular Formula | C20H27NO7 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | tert-butyl [(2-methylpropan-2-yl)oxycarbonyl-(3-oxo-4-phenylbutanoyl)amino] carbonate |
| SMILES | CC(C)(C)OC(=O)ON(C(=O)CC(=O)Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H27NO7/c1-19(2,3)26-17(24)21(28-18(25)27-20(4,5)6)16(23)13-15(22)12-14-10-8-7-9-11-14/h7-11H,12-13H2,1-6H3 |
| InChIKey | IWUKNKFCOUURQS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|