C21H29NO7 — CID 10597520
tert-butyl [[2-methyl-3-(4-methylphenyl)-3-oxopropanoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino] carbonate (PubChem CID 10597520) has the molecular formula C21H29NO7 and a molecular weight of 407.46 g/mol. Its IUPAC name is tert-butyl [[2-methyl-3-(4-methylphenyl)-3-oxopropanoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino] carbonate.
| Compound Name | tert-butyl [[2-methyl-3-(4-methylphenyl)-3-oxopropanoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino] carbonate |
|---|---|
| PubChem CID | 10597520 |
| Molecular Formula | C21H29NO7 |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | tert-butyl [[2-methyl-3-(4-methylphenyl)-3-oxopropanoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino] carbonate |
| SMILES | Cc1ccc(C(=O)C(C)C(=O)N(OC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H29NO7/c1-13-9-11-15(12-10-13)16(23)14(2)17(24)22(18(25)27-20(3,4)5)29-19(26)28-21(6,7)8/h9-12,14H,1-8H3 |
| InChIKey | JFFZGMTZMSCUQK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|