C8H16N2O3S — CID 106443509
(2S)-2-amino-3-(1-amino-1-oxopropan-2-yl)sulfanyl-3-methylbutanoic acid (PubChem CID 106443509) has the molecular formula C8H16N2O3S and a molecular weight of 220.29 g/mol. Its IUPAC name is (2S)-2-amino-3-(1-amino-1-oxopropan-2-yl)sulfanyl-3-methylbutanoic acid.
| Compound Name | (2S)-2-amino-3-(1-amino-1-oxopropan-2-yl)sulfanyl-3-methylbutanoic acid |
|---|---|
| PubChem CID | 106443509 |
| Molecular Formula | C8H16N2O3S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | (2S)-2-amino-3-(1-amino-1-oxopropan-2-yl)sulfanyl-3-methylbutanoic acid |
| SMILES | CC(SC(C)(C)[C@@H](N)C(=O)O)C(N)=O |
| InChI | InChI=1S/C8H16N2O3S/c1-4(6(10)11)14-8(2,3)5(9)7(12)13/h4-5H,9H2,1-3H3,(H2,10,11)(H,12,13)/t4?,5-/m0/s1 |
| InChIKey | VDLCIVOENXLDIV-AKGZTFGVSA-N |
| XLogP | -0.22 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |