C10H20N2O4S2 — CID 87585306
(2R)-2-amino-3-[(2R)-2-carboxy-2-(dimethylamino)-1-sulfanylethyl]sulfanyl-3-methylbutanoic acid (PubChem CID 87585306) has the molecular formula C10H20N2O4S2 and a molecular weight of 296.41 g/mol. Its IUPAC name is (2R)-2-amino-3-[(2R)-2-carboxy-2-(dimethylamino)-1-sulfanylethyl]sulfanyl-3-methylbutanoic acid.
| Compound Name | (2R)-2-amino-3-[(2R)-2-carboxy-2-(dimethylamino)-1-sulfanylethyl]sulfanyl-3-methylbutanoic acid |
|---|---|
| PubChem CID | 87585306 |
| Molecular Formula | C10H20N2O4S2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | (2R)-2-amino-3-[(2R)-2-carboxy-2-(dimethylamino)-1-sulfanylethyl]sulfanyl-3-methylbutanoic acid |
| SMILES | CN(C)[C@H](C(=O)O)C(S)SC(C)(C)[C@H](N)C(=O)O |
| InChI | InChI=1S/C10H20N2O4S2/c1-10(2,6(11)8(15)16)18-9(17)5(7(13)14)12(3)4/h5-6,9,17H,11H2,1-4H3,(H,13,14)(H,15,16)/t5-,6-,9?/m1/s1 |
| InChIKey | ZXZLCWVRPDVNQH-RAJUTSIHSA-N |
| XLogP | 0.18 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|