C20H33NO3S2 — CID 10644641
10-(1,3-thiazolidin-3-yl)decyl 4-methylbenzenesulfonate (PubChem CID 10644641) has the molecular formula C20H33NO3S2 and a molecular weight of 399.62 g/mol. Its IUPAC name is 10-(1,3-thiazolidin-3-yl)decyl 4-methylbenzenesulfonate.
| Compound Name | 10-(1,3-thiazolidin-3-yl)decyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10644641 |
| Molecular Formula | C20H33NO3S2 |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 10-(1,3-thiazolidin-3-yl)decyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCCCCCCCN2CCSC2)cc1 |
| InChI | InChI=1S/C20H33NO3S2/c1-19-10-12-20(13-11-19)26(22,23)24-16-9-7-5-3-2-4-6-8-14-21-15-17-25-18-21/h10-13H,2-9,14-18H2,1H3 |
| InChIKey | CACMRNQLXYFLSJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|