C11H22F3NO2 — CID 106450234
2-[2-(2-methylpropoxy)ethoxy]-N-(2,2,2-trifluoroethyl)propan-1-amine (PubChem CID 106450234) has the molecular formula C11H22F3NO2 and a molecular weight of 257.30 g/mol. Its IUPAC name is 2-[2-(2-methylpropoxy)ethoxy]-N-(2,2,2-trifluoroethyl)propan-1-amine.
| Compound Name | 2-[2-(2-methylpropoxy)ethoxy]-N-(2,2,2-trifluoroethyl)propan-1-amine |
|---|---|
| PubChem CID | 106450234 |
| Molecular Formula | C11H22F3NO2 |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 2-[2-(2-methylpropoxy)ethoxy]-N-(2,2,2-trifluoroethyl)propan-1-amine |
| SMILES | CC(C)COCCOC(C)CNCC(F)(F)F |
| InChI | InChI=1S/C11H22F3NO2/c1-9(2)7-16-4-5-17-10(3)6-15-8-11(12,13)14/h9-10,15H,4-8H2,1-3H3 |
| InChIKey | YLBYRAJEQVHCCB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|