C12H20N2O3 — CID 106451672
2-ethyl-4-[2-(2-methylpropoxy)ethoxy]-1H-pyrimidin-6-one (PubChem CID 106451672) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 2-ethyl-4-[2-(2-methylpropoxy)ethoxy]-1H-pyrimidin-6-one.
| Compound Name | 2-ethyl-4-[2-(2-methylpropoxy)ethoxy]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 106451672 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 2-ethyl-4-[2-(2-methylpropoxy)ethoxy]-1H-pyrimidin-6-one |
| SMILES | CCc1nc(OCCOCC(C)C)cc(=O)[nH]1 |
| InChI | InChI=1S/C12H20N2O3/c1-4-10-13-11(15)7-12(14-10)17-6-5-16-8-9(2)3/h7,9H,4-6,8H2,1-3H3,(H,13,14,15) |
| InChIKey | CRPDOOHUQWMLDW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|