C14H16Cl2N2O4S2 — CID 10645282
N-[(1R,2R,5R,6R)-2,6-dichloro-9lambda4-thiabicyclo[3.3.1]nonan-9-ylidene]-2-nitrobenzenesulfonamide (PubChem CID 10645282) has the molecular formula C14H16Cl2N2O4S2 and a molecular weight of 411.33 g/mol. Its IUPAC name is N-[(1R,2R,5R,6R)-2,6-dichloro-9lambda4-thiabicyclo[3.3.1]nonan-9-ylidene]-2-nitrobenzenesulfonamide.
| Compound Name | N-[(1R,2R,5R,6R)-2,6-dichloro-9lambda4-thiabicyclo[3.3.1]nonan-9-ylidene]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 10645282 |
| Molecular Formula | C14H16Cl2N2O4S2 |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | N-[(1R,2R,5R,6R)-2,6-dichloro-9lambda4-thiabicyclo[3.3.1]nonan-9-ylidene]-2-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)N=S1[C@@H]2CC[C@@H](Cl)[C@H]1CC[C@H]2Cl |
| InChI | InChI=1S/C14H16Cl2N2O4S2/c15-9-5-7-12-10(16)6-8-13(9)23(12)17-24(21,22)14-4-2-1-3-11(14)18(19)20/h1-4,9-10,12-13H,5-8H2/t9-,10-,12-,13-/m1/s1 |
| InChIKey | HYMKODDYLFKIBN-FPQZTECRSA-N |
| XLogP | 3.62 |
| TPSA | 89.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|