C11H14N2O4S — CID 135073989
(NE)-N-(2,2-dimethylpropylidene)-2-nitrobenzenesulfonamide (PubChem CID 135073989) has the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. Its IUPAC name is (NE)-N-(2,2-dimethylpropylidene)-2-nitrobenzenesulfonamide.
| Compound Name | (NE)-N-(2,2-dimethylpropylidene)-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 135073989 |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | (NE)-N-(2,2-dimethylpropylidene)-2-nitrobenzenesulfonamide |
| SMILES | CC(C)(C)/C=N/S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14N2O4S/c1-11(2,3)8-12-18(16,17)10-7-5-4-6-9(10)13(14)15/h4-8H,1-3H3/b12-8+ |
| InChIKey | OOCPCMSSGJWIGC-XYOKQWHBSA-N |
| XLogP | 2.40 |
| TPSA | 89.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|