C12H20O3 — CID 106454928
3-(2-propoxyethyl)bicyclo[3.1.0]hexane-3-carboxylic acid (PubChem CID 106454928) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 3-(2-propoxyethyl)bicyclo[3.1.0]hexane-3-carboxylic acid.
| Compound Name | 3-(2-propoxyethyl)bicyclo[3.1.0]hexane-3-carboxylic acid |
|---|---|
| PubChem CID | 106454928 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 3-(2-propoxyethyl)bicyclo[3.1.0]hexane-3-carboxylic acid |
| SMILES | CCCOCCC1(C(=O)O)CC2CC2C1 |
| InChI | InChI=1S/C12H20O3/c1-2-4-15-5-3-12(11(13)14)7-9-6-10(9)8-12/h9-10H,2-8H2,1H3,(H,13,14) |
| InChIKey | UNHKUBCAWDIXIH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|