C22H31F3O4 — CID 10645562
methyl (7E)-7-[2-hydroxy-2-[(E)-oct-1-enyl]-5-oxo-4-(trifluoromethyl)cyclopent-3-en-1-ylidene]heptanoate (PubChem CID 10645562) has the molecular formula C22H31F3O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is methyl (7E)-7-[2-hydroxy-2-[(E)-oct-1-enyl]-5-oxo-4-(trifluoromethyl)cyclopent-3-en-1-ylidene]heptanoate.
| Compound Name | methyl (7E)-7-[2-hydroxy-2-[(E)-oct-1-enyl]-5-oxo-4-(trifluoromethyl)cyclopent-3-en-1-ylidene]heptanoate |
|---|---|
| PubChem CID | 10645562 |
| Molecular Formula | C22H31F3O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | methyl (7E)-7-[2-hydroxy-2-[(E)-oct-1-enyl]-5-oxo-4-(trifluoromethyl)cyclopent-3-en-1-ylidene]heptanoate |
| SMILES | CCCCCC/C=C/C1(O)C=C(C(F)(F)F)C(=O)/C1=C/CCCCCC(=O)OC |
| InChI | InChI=1S/C22H31F3O4/c1-3-4-5-6-9-12-15-21(28)16-18(22(23,24)25)20(27)17(21)13-10-7-8-11-14-19(26)29-2/h12-13,15-16,28H,3-11,14H2,1-2H3/b15-12+,17-13- |
| InChIKey | QWIBLXQCGONWDH-GXDIDPINSA-N |
| XLogP | 5.37 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|