C19H28O4 — CID 163005404
methyl 8-[(1S,5E)-1-hydroxy-4-oxo-5-[(Z)-pent-2-enylidene]cyclopent-2-en-1-yl]octanoate (PubChem CID 163005404) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is methyl 8-[(1S,5E)-1-hydroxy-4-oxo-5-[(Z)-pent-2-enylidene]cyclopent-2-en-1-yl]octanoate.
| Compound Name | methyl 8-[(1S,5E)-1-hydroxy-4-oxo-5-[(Z)-pent-2-enylidene]cyclopent-2-en-1-yl]octanoate |
|---|---|
| PubChem CID | 163005404 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | methyl 8-[(1S,5E)-1-hydroxy-4-oxo-5-[(Z)-pent-2-enylidene]cyclopent-2-en-1-yl]octanoate |
| SMILES | CC/C=C\C=C1\C(=O)C=C[C@@]1(O)CCCCCCCC(=O)OC |
| InChI | InChI=1S/C19H28O4/c1-3-4-8-11-16-17(20)13-15-19(16,22)14-10-7-5-6-9-12-18(21)23-2/h4,8,11,13,15,22H,3,5-7,9-10,12,14H2,1-2H3/b8-4-,16-11-/t19-/m0/s1 |
| InChIKey | CSKWXYDNGLJFQE-IBLKYEQISA-N |
| XLogP | 3.65 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|