C18H26O4 — CID 162917552
8-[(1R,5E)-1-hydroxy-4-oxo-5-[(E)-pent-2-enylidene]cyclopent-2-en-1-yl]octanoic acid (PubChem CID 162917552) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is 8-[(1R,5E)-1-hydroxy-4-oxo-5-[(E)-pent-2-enylidene]cyclopent-2-en-1-yl]octanoic acid.
| Compound Name | 8-[(1R,5E)-1-hydroxy-4-oxo-5-[(E)-pent-2-enylidene]cyclopent-2-en-1-yl]octanoic acid |
|---|---|
| PubChem CID | 162917552 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 8-[(1R,5E)-1-hydroxy-4-oxo-5-[(E)-pent-2-enylidene]cyclopent-2-en-1-yl]octanoic acid |
| SMILES | CC/C=C/C=C1/C(=O)C=C[C@]1(O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H26O4/c1-2-3-7-10-15-16(19)12-14-18(15,22)13-9-6-4-5-8-11-17(20)21/h3,7,10,12,14,22H,2,4-6,8-9,11,13H2,1H3,(H,20,21)/b7-3+,15-10-/t18-/m1/s1 |
| InChIKey | JCIAXQFIDQSPBE-RQRSKFNTSA-N |
| XLogP | 3.56 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|