About 6,6-dimethyl-1-[2-(2-methylpropoxy)ethyl]-3-propan-2-ylpiperazine-2,5-dione
6,6-dimethyl-1-[2-(2-methylpropoxy)ethyl]-3-propan-2-ylpiperazine-2,5-dione (PubChem CID 106458966) has the molecular formula C15H28N2O3
and a molecular weight of 284.40 g/mol. Its IUPAC name is 6,6-dimethyl-1-[2-(2-methylpropoxy)ethyl]-3-propan-2-ylpiperazine-2,5-dione.
Molecular Properties
| Compound Name | 6,6-dimethyl-1-[2-(2-methylpropoxy)ethyl]-3-propan-2-ylpiperazine-2,5-dione |
| PubChem CID | 106458966 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 6,6-dimethyl-1-[2-(2-methylpropoxy)ethyl]-3-propan-2-ylpiperazine-2,5-dione |
| SMILES | CC(C)COCCN1C(=O)C(C(C)C)NC(=O)C1(C)C |
| InChI | InChI=1S/C15H28N2O3/c1-10(2)9-20-8-7-17-13(18)12(11(3)4)16-14(19)15(17,5)6/h10-12H,7-9H2,1-6H3,(H,16,19) |
| InChIKey | LVWQEMDXLPYXAA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6,6-dimethyl-1-[2-(2-methylpropoxy)ethyl]-3-propan-2-ylpiperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-1-[2-(2-methylpropoxy)ethyl]-3-propan-2-ylpiperazine-2,5-dione?
The IUPAC name of 6,6-dimethyl-1-[2-(2-methylpropoxy)ethyl]-3-propan-2-ylpiperazine-2,5-dione (CID 106458966) is 6,6-dimethyl-1-[2-(2-methylpropoxy)ethyl]-3-propan-2-ylpiperazine-2,5-dione.
What is the SMILES notation for 6,6-dimethyl-1-[2-(2-methylpropoxy)ethyl]-3-propan-2-ylpiperazine-2,5-dione?
The canonical SMILES for 6,6-dimethyl-1-[2-(2-methylpropoxy)ethyl]-3-propan-2-ylpiperazine-2,5-dione is CC(C)COCCN1C(=O)C(C(C)C)NC(=O)C1(C)C.
What is the InChIKey of 6,6-dimethyl-1-[2-(2-methylpropoxy)ethyl]-3-propan-2-ylpiperazine-2,5-dione?
The InChIKey is LVWQEMDXLPYXAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2O3/c1-10(2)9-20-8-7-17-13(18)12(11(3)4)16-14(19)15(17,5)6/h10-12H,7-9H2,1-6H3,(H,16,19).
What are the key properties of 6,6-dimethyl-1-[2-(2-methylpropoxy)ethyl]-3-propan-2-ylpiperazine-2,5-dione?
6,6-dimethyl-1-[2-(2-methylpropoxy)ethyl]-3-propan-2-ylpiperazine-2,5-dione has a molecular weight of 284.40 g/mol, XLogP of 1.42, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-1-[2-(2-methylpropoxy)ethyl]-3-propan-2-ylpiperazine-2,5-dione is sourced from PubChem (CID 106458966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).