C16H28N2O3 — CID 106459076
3-cyclopropyl-3,6,6-trimethyl-1-[2-(2-methylpropoxy)ethyl]piperazine-2,5-dione (PubChem CID 106459076) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is 3-cyclopropyl-3,6,6-trimethyl-1-[2-(2-methylpropoxy)ethyl]piperazine-2,5-dione.
| Compound Name | 3-cyclopropyl-3,6,6-trimethyl-1-[2-(2-methylpropoxy)ethyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 106459076 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 3-cyclopropyl-3,6,6-trimethyl-1-[2-(2-methylpropoxy)ethyl]piperazine-2,5-dione |
| SMILES | CC(C)COCCN1C(=O)C(C)(C2CC2)NC(=O)C1(C)C |
| InChI | InChI=1S/C16H28N2O3/c1-11(2)10-21-9-8-18-14(20)16(5,12-6-7-12)17-13(19)15(18,3)4/h11-12H,6-10H2,1-5H3,(H,17,19) |
| InChIKey | KFVHAJUMTHSFLF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|