C10H18BrN3O2 — CID 106462013
1-(5-bromo-3-methyltriazol-4-yl)-3-ethylpentane-1,2-diol (PubChem CID 106462013) has the molecular formula C10H18BrN3O2 and a molecular weight of 292.18 g/mol. Its IUPAC name is 1-(5-bromo-3-methyltriazol-4-yl)-3-ethylpentane-1,2-diol.
| Compound Name | 1-(5-bromo-3-methyltriazol-4-yl)-3-ethylpentane-1,2-diol |
|---|---|
| PubChem CID | 106462013 |
| Molecular Formula | C10H18BrN3O2 |
| Molecular Weight | 292.18 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 1-(5-bromo-3-methyltriazol-4-yl)-3-ethylpentane-1,2-diol |
| SMILES | CCC(CC)C(O)C(O)c1c(Br)nnn1C |
| InChI | InChI=1S/C10H18BrN3O2/c1-4-6(5-2)8(15)9(16)7-10(11)12-13-14(7)3/h6,8-9,15-16H,4-5H2,1-3H3 |
| InChIKey | BVRHBGHWHQNGDO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.18 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |