C7H11BrCl2N4O2S — CID 106468456
5-bromo-N-(1,3-dichloro-2-methylpropan-2-yl)-3-methyltriazole-4-sulfonamide (PubChem CID 106468456) has the molecular formula C7H11BrCl2N4O2S and a molecular weight of 366.07 g/mol. Its IUPAC name is 5-bromo-N-(1,3-dichloro-2-methylpropan-2-yl)-3-methyltriazole-4-sulfonamide.
| Compound Name | 5-bromo-N-(1,3-dichloro-2-methylpropan-2-yl)-3-methyltriazole-4-sulfonamide |
|---|---|
| PubChem CID | 106468456 |
| Molecular Formula | C7H11BrCl2N4O2S |
| Molecular Weight | 366.07 g/mol |
| Exact Mass | 363.92 |
| IUPAC Name | 5-bromo-N-(1,3-dichloro-2-methylpropan-2-yl)-3-methyltriazole-4-sulfonamide |
| SMILES | Cn1nnc(Br)c1S(=O)(=O)NC(C)(CCl)CCl |
| InChI | InChI=1S/C7H11BrCl2N4O2S/c1-7(3-9,4-10)12-17(15,16)6-5(8)11-13-14(6)2/h12H,3-4H2,1-2H3 |
| InChIKey | ARJANJMMTIXVBI-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.07 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|