About 3-[(3,4-dimethoxy-2-pyridinyl)methyl]-4-oxooxane-3-carboxylic acid
3-[(3,4-dimethoxy-2-pyridinyl)methyl]-4-oxooxane-3-carboxylic acid (PubChem CID 106470008) has the molecular formula C14H17NO6
and a molecular weight of 295.29 g/mol. Its IUPAC name is 3-[(3,4-dimethoxy-2-pyridinyl)methyl]-4-oxooxane-3-carboxylic acid.
Molecular Properties
| Compound Name | 3-[(3,4-dimethoxy-2-pyridinyl)methyl]-4-oxooxane-3-carboxylic acid |
| PubChem CID | 106470008 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 3-[(3,4-dimethoxy-2-pyridinyl)methyl]-4-oxooxane-3-carboxylic acid |
| SMILES | COc1ccnc(CC2(C(=O)O)COCCC2=O)c1OC |
| InChI | InChI=1S/C14H17NO6/c1-19-10-3-5-15-9(12(10)20-2)7-14(13(17)18)8-21-6-4-11(14)16/h3,5H,4,6-8H2,1-2H3,(H,17,18) |
| InChIKey | LLFSBSHHECSGEX-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3,4-dimethoxy-2-pyridinyl)methyl]-4-oxooxane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,4-dimethoxy-2-pyridinyl)methyl]-4-oxooxane-3-carboxylic acid?
The IUPAC name of 3-[(3,4-dimethoxy-2-pyridinyl)methyl]-4-oxooxane-3-carboxylic acid (CID 106470008) is 3-[(3,4-dimethoxy-2-pyridinyl)methyl]-4-oxooxane-3-carboxylic acid.
What is the SMILES notation for 3-[(3,4-dimethoxy-2-pyridinyl)methyl]-4-oxooxane-3-carboxylic acid?
The canonical SMILES for 3-[(3,4-dimethoxy-2-pyridinyl)methyl]-4-oxooxane-3-carboxylic acid is COc1ccnc(CC2(C(=O)O)COCCC2=O)c1OC.
What is the InChIKey of 3-[(3,4-dimethoxy-2-pyridinyl)methyl]-4-oxooxane-3-carboxylic acid?
The InChIKey is LLFSBSHHECSGEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO6/c1-19-10-3-5-15-9(12(10)20-2)7-14(13(17)18)8-21-6-4-11(14)16/h3,5H,4,6-8H2,1-2H3,(H,17,18).
What are the key properties of 3-[(3,4-dimethoxy-2-pyridinyl)methyl]-4-oxooxane-3-carboxylic acid?
3-[(3,4-dimethoxy-2-pyridinyl)methyl]-4-oxooxane-3-carboxylic acid has a molecular weight of 295.29 g/mol, XLogP of 0.70, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,4-dimethoxy-2-pyridinyl)methyl]-4-oxooxane-3-carboxylic acid is sourced from PubChem (CID 106470008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).