C14H17NO6 — CID 106470008
3-[(3,4-dimethoxy-2-pyridinyl)methyl]-4-oxooxane-3-carboxylic acid (PubChem CID 106470008) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is 3-[(3,4-dimethoxy-2-pyridinyl)methyl]-4-oxooxane-3-carboxylic acid.
| Compound Name | 3-[(3,4-dimethoxy-2-pyridinyl)methyl]-4-oxooxane-3-carboxylic acid |
|---|---|
| PubChem CID | 106470008 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 3-[(3,4-dimethoxy-2-pyridinyl)methyl]-4-oxooxane-3-carboxylic acid |
| SMILES | COc1ccnc(CC2(C(=O)O)COCCC2=O)c1OC |
| InChI | InChI=1S/C14H17NO6/c1-19-10-3-5-15-9(12(10)20-2)7-14(13(17)18)8-21-6-4-11(14)16/h3,5H,4,6-8H2,1-2H3,(H,17,18) |
| InChIKey | LLFSBSHHECSGEX-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|