C13H19N3O4 — CID 106470041
3-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methyl]-4-oxooxane-3-carboxylic acid (PubChem CID 106470041) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is 3-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methyl]-4-oxooxane-3-carboxylic acid.
| Compound Name | 3-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methyl]-4-oxooxane-3-carboxylic acid |
|---|---|
| PubChem CID | 106470041 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 3-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methyl]-4-oxooxane-3-carboxylic acid |
| SMILES | CC(C)Cn1ncnc1CC1(C(=O)O)COCCC1=O |
| InChI | InChI=1S/C13H19N3O4/c1-9(2)6-16-11(14-8-15-16)5-13(12(18)19)7-20-4-3-10(13)17/h8-9H,3-7H2,1-2H3,(H,18,19) |
| InChIKey | QUBAABFGNWXFGV-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|