3-(2,2-difluoroethyl)-4-oxooxane-3-carboxylic acid

C8H10F2O4 — CID 106470121

IUPAC3-(2,2-difluoroethyl)-4-oxooxane-3-carboxylic acid
SMILESO=C(O)C1(CC(F)F)COCCC1=O
InChIInChI=1S/C8H10F2O4/c9-6(10)3-8(7(12)13)4-14-2-1-5(8)11/h6H,1-4H2,(H,12,13)
InChIKeyDSONMIGFZJSWEK-UHFFFAOYSA-N
MW208.16 g/mol
LogP0.70
Rot. Bonds3

About 3-(2,2-difluoroethyl)-4-oxooxane-3-carboxylic acid

3-(2,2-difluoroethyl)-4-oxooxane-3-carboxylic acid (PubChem CID 106470121) has the molecular formula C8H10F2O4 and a molecular weight of 208.16 g/mol. Its IUPAC name is 3-(2,2-difluoroethyl)-4-oxooxane-3-carboxylic acid.

Molecular Properties

Compound Name3-(2,2-difluoroethyl)-4-oxooxane-3-carboxylic acid
PubChem CID106470121
Molecular FormulaC8H10F2O4
Molecular Weight208.16 g/mol
Exact Mass208.05
IUPAC Name3-(2,2-difluoroethyl)-4-oxooxane-3-carboxylic acid
SMILESO=C(O)C1(CC(F)F)COCCC1=O
InChIInChI=1S/C8H10F2O4/c9-6(10)3-8(7(12)13)4-14-2-1-5(8)11/h6H,1-4H2,(H,12,13)
InChIKeyDSONMIGFZJSWEK-UHFFFAOYSA-N
XLogP0.70
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.16
LogP ≤ 50.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 3-(2,2-difluoroethyl)-4-oxooxane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,2-difluoroethyl)-4-oxooxane-3-carboxylic acid?
The IUPAC name of 3-(2,2-difluoroethyl)-4-oxooxane-3-carboxylic acid (CID 106470121) is 3-(2,2-difluoroethyl)-4-oxooxane-3-carboxylic acid.
What is the SMILES notation for 3-(2,2-difluoroethyl)-4-oxooxane-3-carboxylic acid?
The canonical SMILES for 3-(2,2-difluoroethyl)-4-oxooxane-3-carboxylic acid is O=C(O)C1(CC(F)F)COCCC1=O.
What is the InChIKey of 3-(2,2-difluoroethyl)-4-oxooxane-3-carboxylic acid?
The InChIKey is DSONMIGFZJSWEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F2O4/c9-6(10)3-8(7(12)13)4-14-2-1-5(8)11/h6H,1-4H2,(H,12,13).
What are the key properties of 3-(2,2-difluoroethyl)-4-oxooxane-3-carboxylic acid?
3-(2,2-difluoroethyl)-4-oxooxane-3-carboxylic acid has a molecular weight of 208.16 g/mol, XLogP of 0.70, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluoroethyl)-4-oxooxane-3-carboxylic acid is sourced from PubChem (CID 106470121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).