C8H10F2O4 — CID 106470121
3-(2,2-difluoroethyl)-4-oxooxane-3-carboxylic acid (PubChem CID 106470121) has the molecular formula C8H10F2O4 and a molecular weight of 208.16 g/mol. Its IUPAC name is 3-(2,2-difluoroethyl)-4-oxooxane-3-carboxylic acid.
| Compound Name | 3-(2,2-difluoroethyl)-4-oxooxane-3-carboxylic acid |
|---|---|
| PubChem CID | 106470121 |
| Molecular Formula | C8H10F2O4 |
| Molecular Weight | 208.16 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 3-(2,2-difluoroethyl)-4-oxooxane-3-carboxylic acid |
| SMILES | O=C(O)C1(CC(F)F)COCCC1=O |
| InChI | InChI=1S/C8H10F2O4/c9-6(10)3-8(7(12)13)4-14-2-1-5(8)11/h6H,1-4H2,(H,12,13) |
| InChIKey | DSONMIGFZJSWEK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.16 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|