4,4-difluoro-3-(2,2,2-trifluoroethyl)oxane-3-carboxylic acid

C8H9F5O3 — CID 84803548

IUPAC4,4-difluoro-3-(2,2,2-trifluoroethyl)oxane-3-carboxylic acid
SMILESO=C(O)C1(CC(F)(F)F)COCCC1(F)F
InChIInChI=1S/C8H9F5O3/c9-7(10)1-2-16-4-6(7,5(14)15)3-8(11,12)13/h1-4H2,(H,14,15)
InChIKeyNAWGTGYZGAQAOB-UHFFFAOYSA-N
MW248.15 g/mol
LogP2.07
Rot. Bonds2

About 4,4-difluoro-3-(2,2,2-trifluoroethyl)oxane-3-carboxylic acid

4,4-difluoro-3-(2,2,2-trifluoroethyl)oxane-3-carboxylic acid (PubChem CID 84803548) has the molecular formula C8H9F5O3 and a molecular weight of 248.15 g/mol. Its IUPAC name is 4,4-difluoro-3-(2,2,2-trifluoroethyl)oxane-3-carboxylic acid.

Molecular Properties

Compound Name4,4-difluoro-3-(2,2,2-trifluoroethyl)oxane-3-carboxylic acid
PubChem CID84803548
Molecular FormulaC8H9F5O3
Molecular Weight248.15 g/mol
Exact Mass248.05
IUPAC Name4,4-difluoro-3-(2,2,2-trifluoroethyl)oxane-3-carboxylic acid
SMILESO=C(O)C1(CC(F)(F)F)COCCC1(F)F
InChIInChI=1S/C8H9F5O3/c9-7(10)1-2-16-4-6(7,5(14)15)3-8(11,12)13/h1-4H2,(H,14,15)
InChIKeyNAWGTGYZGAQAOB-UHFFFAOYSA-N
XLogP2.07
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.15
LogP ≤ 52.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4,4-difluoro-3-(2,2,2-trifluoroethyl)oxane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,4-difluoro-3-(2,2,2-trifluoroethyl)oxane-3-carboxylic acid?
The IUPAC name of 4,4-difluoro-3-(2,2,2-trifluoroethyl)oxane-3-carboxylic acid (CID 84803548) is 4,4-difluoro-3-(2,2,2-trifluoroethyl)oxane-3-carboxylic acid.
What is the SMILES notation for 4,4-difluoro-3-(2,2,2-trifluoroethyl)oxane-3-carboxylic acid?
The canonical SMILES for 4,4-difluoro-3-(2,2,2-trifluoroethyl)oxane-3-carboxylic acid is O=C(O)C1(CC(F)(F)F)COCCC1(F)F.
What is the InChIKey of 4,4-difluoro-3-(2,2,2-trifluoroethyl)oxane-3-carboxylic acid?
The InChIKey is NAWGTGYZGAQAOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F5O3/c9-7(10)1-2-16-4-6(7,5(14)15)3-8(11,12)13/h1-4H2,(H,14,15).
What are the key properties of 4,4-difluoro-3-(2,2,2-trifluoroethyl)oxane-3-carboxylic acid?
4,4-difluoro-3-(2,2,2-trifluoroethyl)oxane-3-carboxylic acid has a molecular weight of 248.15 g/mol, XLogP of 2.07, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-3-(2,2,2-trifluoroethyl)oxane-3-carboxylic acid is sourced from PubChem (CID 84803548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).