C11H18F2O3 — CID 84798064
3-(2,2-dimethylpropyl)-4,4-difluorooxane-3-carboxylic acid (PubChem CID 84798064) has the molecular formula C11H18F2O3 and a molecular weight of 236.26 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)-4,4-difluorooxane-3-carboxylic acid.
| Compound Name | 3-(2,2-dimethylpropyl)-4,4-difluorooxane-3-carboxylic acid |
|---|---|
| PubChem CID | 84798064 |
| Molecular Formula | C11H18F2O3 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 3-(2,2-dimethylpropyl)-4,4-difluorooxane-3-carboxylic acid |
| SMILES | CC(C)(C)CC1(C(=O)O)COCCC1(F)F |
| InChI | InChI=1S/C11H18F2O3/c1-9(2,3)6-10(8(14)15)7-16-5-4-11(10,12)13/h4-7H2,1-3H3,(H,14,15) |
| InChIKey | WZQGFUZVDGFCDU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |