C14H20N2O4 — CID 106473998
3-[3-(1-methoxycyclohexyl)-1,2,4-oxadiazol-5-yl]oxan-4-one (PubChem CID 106473998) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 3-[3-(1-methoxycyclohexyl)-1,2,4-oxadiazol-5-yl]oxan-4-one.
| Compound Name | 3-[3-(1-methoxycyclohexyl)-1,2,4-oxadiazol-5-yl]oxan-4-one |
|---|---|
| PubChem CID | 106473998 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 3-[3-(1-methoxycyclohexyl)-1,2,4-oxadiazol-5-yl]oxan-4-one |
| SMILES | COC1(c2noc(C3COCCC3=O)n2)CCCCC1 |
| InChI | InChI=1S/C14H20N2O4/c1-18-14(6-3-2-4-7-14)13-15-12(20-16-13)10-9-19-8-5-11(10)17/h10H,2-9H2,1H3 |
| InChIKey | IXCPJZLVBAZJLU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |